C23H20BrNO6 — CID 4574158
9-bromo-2-ethyl-6-[5-(hydroxymethyl)furan-2-yl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4574158) has the molecular formula C23H20BrNO6 and a molecular weight of 486.32 g/mol. Its IUPAC name is 9-bromo-2-ethyl-6-[5-(hydroxymethyl)furan-2-yl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 9-bromo-2-ethyl-6-[5-(hydroxymethyl)furan-2-yl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4574158 |
| Molecular Formula | C23H20BrNO6 |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 485.05 |
| IUPAC Name | 9-bromo-2-ethyl-6-[5-(hydroxymethyl)furan-2-yl]-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCN1C(=O)C2CC=C3C(c4ccc(CO)o4)C4=C(CC3C2C1=O)C(=O)C(Br)=CC4=O |
| InChI | InChI=1S/C23H20BrNO6/c1-2-25-22(29)12-5-4-11-13(18(12)23(25)30)7-14-19(16(27)8-15(24)21(14)28)20(11)17-6-3-10(9-26)31-17/h3-4,6,8,12-13,18,20,26H,2,5,7,9H2,1H3 |
| InChIKey | KZAOENMYJAZELW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|