C24H19BrClNO5 — CID 5195553
9-bromo-6-(2-chloro-4-hydroxyphenyl)-2-ethyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5195553) has the molecular formula C24H19BrClNO5 and a molecular weight of 516.78 g/mol. Its IUPAC name is 9-bromo-6-(2-chloro-4-hydroxyphenyl)-2-ethyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 9-bromo-6-(2-chloro-4-hydroxyphenyl)-2-ethyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5195553 |
| Molecular Formula | C24H19BrClNO5 |
| Molecular Weight | 516.78 g/mol |
| Exact Mass | 515.01 |
| IUPAC Name | 9-bromo-6-(2-chloro-4-hydroxyphenyl)-2-ethyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CCN1C(=O)C2CC=C3C(c4ccc(O)cc4Cl)C4=C(CC3C2C1=O)C(=O)C(Br)=CC4=O |
| InChI | InChI=1S/C24H19BrClNO5/c1-2-27-23(31)13-6-5-11-14(20(13)24(27)32)8-15-21(18(29)9-16(25)22(15)30)19(11)12-4-3-10(28)7-17(12)26/h3-5,7,9,13-14,19-20,28H,2,6,8H2,1H3 |
| InChIKey | DFWFHQVAICWRNY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.78 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|