C23H20N2O7 — CID 4614693
6-[5-(hydroxymethyl)furan-2-yl]-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxamide (PubChem CID 4614693) has the molecular formula C23H20N2O7 and a molecular weight of 436.42 g/mol. Its IUPAC name is 6-[5-(hydroxymethyl)furan-2-yl]-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxamide.
| Compound Name | 6-[5-(hydroxymethyl)furan-2-yl]-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxamide |
|---|---|
| PubChem CID | 4614693 |
| Molecular Formula | C23H20N2O7 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 6-[5-(hydroxymethyl)furan-2-yl]-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxamide |
| SMILES | CC1=CC(=O)C2=C(CC3C(=CCC4C(=O)N(C(N)=O)C(=O)C43)C2c2ccc(CO)o2)C1=O |
| InChI | InChI=1S/C23H20N2O7/c1-9-6-15(27)18-14(20(9)28)7-13-11(19(18)16-5-2-10(8-26)32-16)3-4-12-17(13)22(30)25(21(12)29)23(24)31/h2-3,5-6,12-13,17,19,26H,4,7-8H2,1H3,(H2,24,31) |
| InChIKey | RHEZQWJWNKCMOD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 147.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|