C25H23NO8 — CID 5091411
3-[6-[5-(hydroxymethyl)furan-2-yl]-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]propanoic acid (PubChem CID 5091411) has the molecular formula C25H23NO8 and a molecular weight of 465.46 g/mol. Its IUPAC name is 3-[6-[5-(hydroxymethyl)furan-2-yl]-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[6-[5-(hydroxymethyl)furan-2-yl]-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 5091411 |
| Molecular Formula | C25H23NO8 |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 3-[6-[5-(hydroxymethyl)furan-2-yl]-9-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]propanoic acid |
| SMILES | CC1=CC(=O)C2=C(CC3C(=CCC4C(=O)N(CCC(=O)O)C(=O)C43)C2c2ccc(CO)o2)C1=O |
| InChI | InChI=1S/C25H23NO8/c1-11-8-17(28)21-16(23(11)31)9-15-13(22(21)18-5-2-12(10-27)34-18)3-4-14-20(15)25(33)26(24(14)32)7-6-19(29)30/h2-3,5,8,14-15,20,22,27H,4,6-7,9-10H2,1H3,(H,29,30) |
| InChIKey | BWHGHNWWGBKUHV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|