C27H26BrNO8 — CID 6663072
6-[(3aS,6S,11aS,11bR)-9-bromo-6-[5-(hydroxymethyl)furan-2-yl]-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid (PubChem CID 6663072) has the molecular formula C27H26BrNO8 and a molecular weight of 572.41 g/mol. Its IUPAC name is 6-[(3aS,6S,11aS,11bR)-9-bromo-6-[5-(hydroxymethyl)furan-2-yl]-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid.
| Compound Name | 6-[(3aS,6S,11aS,11bR)-9-bromo-6-[5-(hydroxymethyl)furan-2-yl]-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 6663072 |
| Molecular Formula | C27H26BrNO8 |
| Molecular Weight | 572.41 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | 6-[(3aS,6S,11aS,11bR)-9-bromo-6-[5-(hydroxymethyl)furan-2-yl]-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)[C@H]2[C@H](CC=C3[C@H](c4ccc(CO)o4)C4=C(C[C@H]32)C(=O)C(Br)=CC4=O)C1=O |
| InChI | InChI=1S/C27H26BrNO8/c28-18-11-19(31)23-17(25(18)34)10-16-14(24(23)20-8-5-13(12-30)37-20)6-7-15-22(16)27(36)29(26(15)35)9-3-1-2-4-21(32)33/h5-6,8,11,15-16,22,24,30H,1-4,7,9-10,12H2,(H,32,33)/t15-,16+,22-,24+/m0/s1 |
| InChIKey | IVPOKXXNBZJSDU-WMHBSFBOSA-N |
| XLogP | 3.18 |
| TPSA | 142.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|