C30H26BrNO5 — CID 4075446
9-bromo-2-tert-butyl-6-(2-hydroxynaphthalen-1-yl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4075446) has the molecular formula C30H26BrNO5 and a molecular weight of 560.44 g/mol. Its IUPAC name is 9-bromo-2-tert-butyl-6-(2-hydroxynaphthalen-1-yl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 9-bromo-2-tert-butyl-6-(2-hydroxynaphthalen-1-yl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4075446 |
| Molecular Formula | C30H26BrNO5 |
| Molecular Weight | 560.44 g/mol |
| Exact Mass | 559.10 |
| IUPAC Name | 9-bromo-2-tert-butyl-6-(2-hydroxynaphthalen-1-yl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CC(C)(C)N1C(=O)C2CC=C3C(c4c(O)ccc5ccccc45)C4=C(CC3C2C1=O)C(=O)C(Br)=CC4=O |
| InChI | InChI=1S/C30H26BrNO5/c1-30(2,3)32-28(36)17-10-9-16-18(23(17)29(32)37)12-19-25(22(34)13-20(31)27(19)35)26(16)24-15-7-5-4-6-14(15)8-11-21(24)33/h4-9,11,13,17-18,23,26,33H,10,12H2,1-3H3 |
| InChIKey | IESRZMASXOPQGS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|