C29H28FNO7 — CID 6664896
6-[(3aS,6R,11aS,11bR)-6-(3-fluoro-2-hydroxyphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid (PubChem CID 6664896) has the molecular formula C29H28FNO7 and a molecular weight of 521.54 g/mol. Its IUPAC name is 6-[(3aS,6R,11aS,11bR)-6-(3-fluoro-2-hydroxyphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid.
| Compound Name | 6-[(3aS,6R,11aS,11bR)-6-(3-fluoro-2-hydroxyphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 6664896 |
| Molecular Formula | C29H28FNO7 |
| Molecular Weight | 521.54 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 6-[(3aS,6R,11aS,11bR)-6-(3-fluoro-2-hydroxyphenyl)-8-methyl-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]hexanoic acid |
| SMILES | CC1=CC(=O)C2=C(C1=O)[C@@H](c1cccc(F)c1O)C1=CC[C@@H]3C(=O)N(CCCCCC(=O)O)C(=O)[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C29H28FNO7/c1-14-12-21(32)19-13-18-15(23(25(19)26(14)35)16-6-5-7-20(30)27(16)36)9-10-17-24(18)29(38)31(28(17)37)11-4-2-3-8-22(33)34/h5-7,9,12,17-18,23-24,36H,2-4,8,10-11,13H2,1H3,(H,33,34)/t17-,18+,23+,24-/m0/s1 |
| InChIKey | ZZALJADXDXURIP-QWAURFOWSA-N |
| XLogP | 3.61 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.54 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|