C25H20BrNO8 — CID 6661871
methyl (3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxy-3-methoxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate (PubChem CID 6661871) has the molecular formula C25H20BrNO8 and a molecular weight of 542.34 g/mol. Its IUPAC name is methyl (3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxy-3-methoxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate.
| Compound Name | methyl (3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxy-3-methoxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 6661871 |
| Molecular Formula | C25H20BrNO8 |
| Molecular Weight | 542.34 g/mol |
| Exact Mass | 541.04 |
| IUPAC Name | methyl (3aS,6R,11aS,11bR)-9-bromo-6-(2-hydroxy-3-methoxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)[C@H]2[C@H](CC=C3[C@H](c4cccc(OC)c4O)C4=C(C[C@H]32)C(=O)C(Br)=CC4=O)C1=O |
| InChI | InChI=1S/C25H20BrNO8/c1-34-17-5-3-4-11(22(17)30)18-10-6-7-12-19(24(32)27(23(12)31)25(33)35-2)13(10)8-14-20(18)16(28)9-15(26)21(14)29/h3-6,9,12-13,18-19,30H,7-8H2,1-2H3/t12-,13+,18+,19-/m0/s1 |
| InChIKey | UTUIHESBIHBFOY-PRSFTHDCSA-N |
| XLogP | 2.93 |
| TPSA | 127.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|