C29H21BrClNO6 — CID 4101863
9-bromo-2-(4-chlorophenyl)-6-(2-hydroxy-3-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4101863) has the molecular formula C29H21BrClNO6 and a molecular weight of 594.85 g/mol. Its IUPAC name is 9-bromo-2-(4-chlorophenyl)-6-(2-hydroxy-3-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 9-bromo-2-(4-chlorophenyl)-6-(2-hydroxy-3-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4101863 |
| Molecular Formula | C29H21BrClNO6 |
| Molecular Weight | 594.85 g/mol |
| Exact Mass | 593.02 |
| IUPAC Name | 9-bromo-2-(4-chlorophenyl)-6-(2-hydroxy-3-methoxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cccc(C2C3=CCC4C(=O)N(c5ccc(Cl)cc5)C(=O)C4C3CC3=C2C(=O)C=C(Br)C3=O)c1O |
| InChI | InChI=1S/C29H21BrClNO6/c1-38-22-4-2-3-16(27(22)35)23-15-9-10-17-24(18(15)11-19-25(23)21(33)12-20(30)26(19)34)29(37)32(28(17)36)14-7-5-13(31)6-8-14/h2-9,12,17-18,23-24,35H,10-11H2,1H3 |
| InChIKey | LKFPCPGUPIORRN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.85 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|