C28H26BrNO8 — CID 5085281
4-[9-bromo-6-(3-ethoxy-2-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]butanoic acid (PubChem CID 5085281) has the molecular formula C28H26BrNO8 and a molecular weight of 584.42 g/mol. Its IUPAC name is 4-[9-bromo-6-(3-ethoxy-2-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[9-bromo-6-(3-ethoxy-2-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 5085281 |
| Molecular Formula | C28H26BrNO8 |
| Molecular Weight | 584.42 g/mol |
| Exact Mass | 583.08 |
| IUPAC Name | 4-[9-bromo-6-(3-ethoxy-2-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]butanoic acid |
| SMILES | CCOc1cccc(C2C3=CCC4C(=O)N(CCCC(=O)O)C(=O)C4C3CC3=C2C(=O)C=C(Br)C3=O)c1O |
| InChI | InChI=1S/C28H26BrNO8/c1-2-38-20-6-3-5-14(26(20)35)22-13-8-9-15-23(28(37)30(27(15)36)10-4-7-21(32)33)16(13)11-17-24(22)19(31)12-18(29)25(17)34/h3,5-6,8,12,15-16,22-23,35H,2,4,7,9-11H2,1H3,(H,32,33) |
| InChIKey | NVVDBMUFICJGTK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|