C31H24BrNO9 — CID 5103285
4-[9-bromo-6-(3-ethoxy-2-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid (PubChem CID 5103285) has the molecular formula C31H24BrNO9 and a molecular weight of 634.44 g/mol. Its IUPAC name is 4-[9-bromo-6-(3-ethoxy-2-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[9-bromo-6-(3-ethoxy-2-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 5103285 |
| Molecular Formula | C31H24BrNO9 |
| Molecular Weight | 634.44 g/mol |
| Exact Mass | 633.06 |
| IUPAC Name | 4-[9-bromo-6-(3-ethoxy-2-hydroxyphenyl)-1,3,7,10-tetraoxo-3a,4,6,11,11a,11b-hexahydronaphtho[2,3-e]isoindol-2-yl]-2-hydroxybenzoic acid |
| SMILES | CCOc1cccc(C2C3=CCC4C(=O)N(c5ccc(C(=O)O)c(O)c5)C(=O)C4C3CC3=C2C(=O)C=C(Br)C3=O)c1O |
| InChI | InChI=1S/C31H24BrNO9/c1-2-42-23-5-3-4-16(28(23)37)24-14-8-9-17-25(18(14)11-19-26(24)22(35)12-20(32)27(19)36)30(39)33(29(17)38)13-6-7-15(31(40)41)21(34)10-13/h3-8,10,12,17-18,24-25,34,37H,2,9,11H2,1H3,(H,40,41) |
| InChIKey | WLTKQCSQQQUZLT-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 158.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|