C24H24FN3O5 — CID 6641189
(2R,3S,8R,10R)-2-(3-fluoro-2-hydroxyphenyl)-3,5,6,13-tetramethyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 6641189) has the molecular formula C24H24FN3O5 and a molecular weight of 453.47 g/mol. Its IUPAC name is (2R,3S,8R,10R)-2-(3-fluoro-2-hydroxyphenyl)-3,5,6,13-tetramethyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | (2R,3S,8R,10R)-2-(3-fluoro-2-hydroxyphenyl)-3,5,6,13-tetramethyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6641189 |
| Molecular Formula | C24H24FN3O5 |
| Molecular Weight | 453.47 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (2R,3S,8R,10R)-2-(3-fluoro-2-hydroxyphenyl)-3,5,6,13-tetramethyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | CC1=C(C)C(=O)[C@@]2(C)[C@@H](c3cccc(F)c3O)C3=CCn4c(=O)n(C)c(=O)n4[C@@H]3C[C@H]2C1=O |
| InChI | InChI=1S/C24H24FN3O5/c1-11-12(2)21(31)24(3)15(19(11)29)10-17-13(18(24)14-6-5-7-16(25)20(14)30)8-9-27-22(32)26(4)23(33)28(17)27/h5-8,15,17-18,30H,9-10H2,1-4H3/t15-,17+,18+,24+/m0/s1 |
| InChIKey | XOPIQJMDHJGDKS-YQCHORPJSA-N |
| XLogP | 1.97 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|