C23H22ClN3O5 — CID 6641123
(2S,3S,8R,10R)-2-(2-chloro-4-hydroxyphenyl)-3,6,13-trimethyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 6641123) has the molecular formula C23H22ClN3O5 and a molecular weight of 455.90 g/mol. Its IUPAC name is (2S,3S,8R,10R)-2-(2-chloro-4-hydroxyphenyl)-3,6,13-trimethyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | (2S,3S,8R,10R)-2-(2-chloro-4-hydroxyphenyl)-3,6,13-trimethyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6641123 |
| Molecular Formula | C23H22ClN3O5 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | (2S,3S,8R,10R)-2-(2-chloro-4-hydroxyphenyl)-3,6,13-trimethyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | CC1=CC(=O)[C@@]2(C)[C@@H](c3ccc(O)cc3Cl)C3=CCn4c(=O)n(C)c(=O)n4[C@@H]3C[C@H]2C1=O |
| InChI | InChI=1S/C23H22ClN3O5/c1-11-8-18(29)23(2)15(20(11)30)10-17-14(19(23)13-5-4-12(28)9-16(13)24)6-7-26-21(31)25(3)22(32)27(17)26/h4-6,8-9,15,17,19,28H,7,10H2,1-3H3/t15-,17+,19-,23-/m0/s1 |
| InChIKey | KEDHDDDMYZHXNW-GHORPLNESA-N |
| XLogP | 2.10 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|