C37H29N3O5 — CID 6640934
(2R,3S,8R,10R)-2-(2-hydroxynaphthalen-1-yl)-13-methyl-3,6-diphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone (PubChem CID 6640934) has the molecular formula C37H29N3O5 and a molecular weight of 595.66 g/mol. Its IUPAC name is (2R,3S,8R,10R)-2-(2-hydroxynaphthalen-1-yl)-13-methyl-3,6-diphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone.
| Compound Name | (2R,3S,8R,10R)-2-(2-hydroxynaphthalen-1-yl)-13-methyl-3,6-diphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
|---|---|
| PubChem CID | 6640934 |
| Molecular Formula | C37H29N3O5 |
| Molecular Weight | 595.66 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | (2R,3S,8R,10R)-2-(2-hydroxynaphthalen-1-yl)-13-methyl-3,6-diphenyl-11,13,15-triazatetracyclo[8.7.0.03,8.011,15]heptadeca-1(17),5-diene-4,7,12,14-tetrone |
| SMILES | Cn1c(=O)n2n(c1=O)[C@@H]1C[C@H]3C(=O)C(c4ccccc4)=CC(=O)[C@@]3(c3ccccc3)[C@@H](c3c(O)ccc4ccccc34)C1=CC2 |
| InChI | InChI=1S/C37H29N3O5/c1-38-35(44)39-19-18-26-29(40(39)36(38)45)21-28-34(43)27(22-10-4-2-5-11-22)20-31(42)37(28,24-13-6-3-7-14-24)33(26)32-25-15-9-8-12-23(25)16-17-30(32)41/h2-18,20,28-29,33,41H,19,21H2,1H3/t28-,29+,33+,37-/m0/s1 |
| InChIKey | PAKLWGVBOAMOPV-QSHGHKFQSA-N |
| XLogP | 4.67 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.66 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|