C40H39NO7 — CID 6660472
(3aS,6R,6aS,10aR,11aS,11bR)-2-tert-butyl-6-(2-hydroxy-4,6-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6660472) has the molecular formula C40H39NO7 and a molecular weight of 645.75 g/mol. Its IUPAC name is (3aS,6R,6aS,10aR,11aS,11bR)-2-tert-butyl-6-(2-hydroxy-4,6-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,6aS,10aR,11aS,11bR)-2-tert-butyl-6-(2-hydroxy-4,6-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6660472 |
| Molecular Formula | C40H39NO7 |
| Molecular Weight | 645.75 g/mol |
| Exact Mass | 645.27 |
| IUPAC Name | (3aS,6R,6aS,10aR,11aS,11bR)-2-tert-butyl-6-(2-hydroxy-4,6-dimethoxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(O)c([C@H]2C3=CC[C@@H]4C(=O)N(C(C)(C)C)C(=O)[C@@H]4[C@@H]3C[C@H]3C(=O)C(c4ccccc4)=CC(=O)[C@@]23c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C40H39NO7/c1-39(2,3)41-37(45)26-17-16-25-28(33(26)38(41)46)20-29-36(44)27(22-12-8-6-9-13-22)21-32(43)40(29,23-14-10-7-11-15-23)35(25)34-30(42)18-24(47-4)19-31(34)48-5/h6-16,18-19,21,26,28-29,33,35,42H,17,20H2,1-5H3/t26-,28+,29-,33-,35+,40-/m0/s1 |
| InChIKey | ZSIGNSXRQANADI-OTNNRYJXSA-N |
| XLogP | 6.03 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.75 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|