C42H34INO6 — CID 4121030
6-[4-(2-hydroxyethoxy)phenyl]-2-(4-iodophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4121030) has the molecular formula C42H34INO6 and a molecular weight of 775.64 g/mol. Its IUPAC name is 6-[4-(2-hydroxyethoxy)phenyl]-2-(4-iodophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-[4-(2-hydroxyethoxy)phenyl]-2-(4-iodophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4121030 |
| Molecular Formula | C42H34INO6 |
| Molecular Weight | 775.64 g/mol |
| Exact Mass | 775.14 |
| IUPAC Name | 6-[4-(2-hydroxyethoxy)phenyl]-2-(4-iodophenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C(c2ccccc2)=CC(=O)C2(c3ccccc3)C1CC1C(=CCC3C(=O)N(c4ccc(I)cc4)C(=O)C31)C2c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C42H34INO6/c43-28-13-15-29(16-14-28)44-40(48)32-20-19-31-34(37(32)41(44)49)23-35-39(47)33(25-7-3-1-4-8-25)24-36(46)42(35,27-9-5-2-6-10-27)38(31)26-11-17-30(18-12-26)50-22-21-45/h1-19,24,32,34-35,37-38,45H,20-23H2 |
| InChIKey | LJGQQLHTCGXVPC-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.64 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|