C40H31NO9 — CID 3313598
2-hydroxy-4-[6-[5-(hydroxymethyl)furan-2-yl]-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]benzoic acid (PubChem CID 3313598) has the molecular formula C40H31NO9 and a molecular weight of 669.69 g/mol. Its IUPAC name is 2-hydroxy-4-[6-[5-(hydroxymethyl)furan-2-yl]-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]benzoic acid.
| Compound Name | 2-hydroxy-4-[6-[5-(hydroxymethyl)furan-2-yl]-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 3313598 |
| Molecular Formula | C40H31NO9 |
| Molecular Weight | 669.69 g/mol |
| Exact Mass | 669.20 |
| IUPAC Name | 2-hydroxy-4-[6-[5-(hydroxymethyl)furan-2-yl]-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(N2C(=O)C3CC=C4C(CC5C(=O)C(c6ccccc6)=CC(=O)C5(c5ccccc5)C4c4ccc(CO)o4)C3C2=O)cc1O |
| InChI | InChI=1S/C40H31NO9/c42-20-24-12-16-32(50-24)35-25-14-15-27-34(38(47)41(37(27)46)23-11-13-26(39(48)49)31(43)17-23)29(25)18-30-36(45)28(21-7-3-1-4-8-21)19-33(44)40(30,35)22-9-5-2-6-10-22/h1-14,16-17,19,27,29-30,34-35,42-43H,15,18,20H2,(H,48,49) |
| InChIKey | WFNKZUFOVUGHGX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 162.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.69 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|