C35H29NO5 — CID 3699530
6-(3-hydroxyphenyl)-2-methyl-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 3699530) has the molecular formula C35H29NO5 and a molecular weight of 543.62 g/mol. Its IUPAC name is 6-(3-hydroxyphenyl)-2-methyl-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 6-(3-hydroxyphenyl)-2-methyl-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 3699530 |
| Molecular Formula | C35H29NO5 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 6-(3-hydroxyphenyl)-2-methyl-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CN1C(=O)C2CC=C3C(CC4C(=O)C(c5ccccc5)=CC(=O)C4(c4ccccc4)C3c3cccc(O)c3)C2C1=O |
| InChI | InChI=1S/C35H29NO5/c1-36-33(40)25-16-15-24-27(30(25)34(36)41)18-28-32(39)26(20-9-4-2-5-10-20)19-29(38)35(28,22-12-6-3-7-13-22)31(24)21-11-8-14-23(37)17-21/h2-15,17,19,25,27-28,30-31,37H,16,18H2,1H3 |
| InChIKey | KVEMHECWFJSUJU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|