C41H31ClF3N3O5 — CID 5081445
2-[[3-chloro-6-(trifluoromethyl)-2-pyridinyl]-methylamino]-6-(4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 5081445) has the molecular formula C41H31ClF3N3O5 and a molecular weight of 738.16 g/mol. Its IUPAC name is 2-[[3-chloro-6-(trifluoromethyl)-2-pyridinyl]-methylamino]-6-(4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-[[3-chloro-6-(trifluoromethyl)-2-pyridinyl]-methylamino]-6-(4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 5081445 |
| Molecular Formula | C41H31ClF3N3O5 |
| Molecular Weight | 738.16 g/mol |
| Exact Mass | 737.19 |
| IUPAC Name | 2-[[3-chloro-6-(trifluoromethyl)-2-pyridinyl]-methylamino]-6-(4-hydroxyphenyl)-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | CN(c1nc(C(F)(F)F)ccc1Cl)N1C(=O)C2CC=C3C(CC4C(=O)C(c5ccccc5)=CC(=O)C4(c4ccccc4)C3c3ccc(O)cc3)C2C1=O |
| InChI | InChI=1S/C41H31ClF3N3O5/c1-47(37-31(42)18-19-32(46-37)41(43,44)45)48-38(52)27-17-16-26-29(34(27)39(48)53)20-30-36(51)28(22-8-4-2-5-9-22)21-33(50)40(30,24-10-6-3-7-11-24)35(26)23-12-14-25(49)15-13-23/h2-16,18-19,21,27,29-30,34-35,49H,17,20H2,1H3 |
| InChIKey | IAHVEXHTEHAXHQ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.16 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|