C38H32INO8 — CID 3325346
3-[6-(4-hydroxy-3-iodo-5-methoxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]propanoic acid (PubChem CID 3325346) has the molecular formula C38H32INO8 and a molecular weight of 757.58 g/mol. Its IUPAC name is 3-[6-(4-hydroxy-3-iodo-5-methoxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[6-(4-hydroxy-3-iodo-5-methoxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 3325346 |
| Molecular Formula | C38H32INO8 |
| Molecular Weight | 757.58 g/mol |
| Exact Mass | 757.12 |
| IUPAC Name | 3-[6-(4-hydroxy-3-iodo-5-methoxyphenyl)-1,3,7,10-tetraoxo-6a,9-diphenyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]propanoic acid |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(CCC(=O)O)C(=O)C4C3CC3C(=O)C(c4ccccc4)=CC(=O)C32c2ccccc2)cc(I)c1O |
| InChI | InChI=1S/C38H32INO8/c1-48-29-17-21(16-28(39)35(29)45)33-23-12-13-24-32(37(47)40(36(24)46)15-14-31(42)43)26(23)18-27-34(44)25(20-8-4-2-5-9-20)19-30(41)38(27,33)22-10-6-3-7-11-22/h2-12,16-17,19,24,26-27,32-33,45H,13-15,18H2,1H3,(H,42,43) |
| InChIKey | VNACPCCUAFAOCV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.58 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|