C29H22Br2Cl2N2O8 — CID 3287589
3-[6a,9a-dichloro-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid (PubChem CID 3287589) has the molecular formula C29H22Br2Cl2N2O8 and a molecular weight of 757.21 g/mol. Its IUPAC name is 3-[6a,9a-dichloro-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[6a,9a-dichloro-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 3287589 |
| Molecular Formula | C29H22Br2Cl2N2O8 |
| Molecular Weight | 757.21 g/mol |
| Exact Mass | 753.91 |
| IUPAC Name | 3-[6a,9a-dichloro-6-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)-8-methyl-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5cccc(C(=O)O)c5)C(=O)C4C3CC3(Cl)C(=O)N(C)C(=O)C23Cl)c(Br)c(Br)c1O |
| InChI | InChI=1S/C29H22Br2Cl2N2O8/c1-34-26(41)28(32)10-16-13(19(29(28,33)27(34)42)15-9-17(43-2)22(36)21(31)20(15)30)6-7-14-18(16)24(38)35(23(14)37)12-5-3-4-11(8-12)25(39)40/h3-6,8-9,14,16,18-19,36H,7,10H2,1-2H3,(H,39,40) |
| InChIKey | VYDZPHXZOBTFIT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.21 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|