C34H21Cl2F5N2O7 — CID 4598179
3-[6a,9a-dichloro-6-(2-hydroxy-3-methylphenyl)-1,3,7,9-tetraoxo-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid (PubChem CID 4598179) has the molecular formula C34H21Cl2F5N2O7 and a molecular weight of 735.45 g/mol. Its IUPAC name is 3-[6a,9a-dichloro-6-(2-hydroxy-3-methylphenyl)-1,3,7,9-tetraoxo-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[6a,9a-dichloro-6-(2-hydroxy-3-methylphenyl)-1,3,7,9-tetraoxo-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 4598179 |
| Molecular Formula | C34H21Cl2F5N2O7 |
| Molecular Weight | 735.45 g/mol |
| Exact Mass | 734.06 |
| IUPAC Name | 3-[6a,9a-dichloro-6-(2-hydroxy-3-methylphenyl)-1,3,7,9-tetraoxo-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid |
| SMILES | Cc1cccc(C2C3=CCC4C(=O)N(c5cccc(C(=O)O)c5)C(=O)C4C3CC3(Cl)C(=O)N(c4c(F)c(F)c(F)c(F)c4F)C(=O)C23Cl)c1O |
| InChI | InChI=1S/C34H21Cl2F5N2O7/c1-12-4-2-7-17(27(12)44)20-15-8-9-16-19(29(46)42(28(16)45)14-6-3-5-13(10-14)30(47)48)18(15)11-33(35)31(49)43(32(50)34(20,33)36)26-24(40)22(38)21(37)23(39)25(26)41/h2-8,10,16,18-20,44H,9,11H2,1H3,(H,47,48) |
| InChIKey | SOLVXRLFCXDARE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.45 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|