C34H21Cl2F5N2O8 — CID 3347834
3-[6a,9a-dichloro-6-(2-hydroxy-4-methoxyphenyl)-1,3,7,9-tetraoxo-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid (PubChem CID 3347834) has the molecular formula C34H21Cl2F5N2O8 and a molecular weight of 751.44 g/mol. Its IUPAC name is 3-[6a,9a-dichloro-6-(2-hydroxy-4-methoxyphenyl)-1,3,7,9-tetraoxo-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[6a,9a-dichloro-6-(2-hydroxy-4-methoxyphenyl)-1,3,7,9-tetraoxo-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 3347834 |
| Molecular Formula | C34H21Cl2F5N2O8 |
| Molecular Weight | 751.44 g/mol |
| Exact Mass | 750.06 |
| IUPAC Name | 3-[6a,9a-dichloro-6-(2-hydroxy-4-methoxyphenyl)-1,3,7,9-tetraoxo-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid |
| SMILES | COc1ccc(C2C3=CCC4C(=O)N(c5cccc(C(=O)O)c5)C(=O)C4C3CC3(Cl)C(=O)N(c4c(F)c(F)c(F)c(F)c4F)C(=O)C23Cl)c(O)c1 |
| InChI | InChI=1S/C34H21Cl2F5N2O8/c1-51-14-5-6-16(19(44)10-14)21-15-7-8-17-20(29(46)42(28(17)45)13-4-2-3-12(9-13)30(47)48)18(15)11-33(35)31(49)43(32(50)34(21,33)36)27-25(40)23(38)22(37)24(39)26(27)41/h2-7,9-10,17-18,20-21,44H,8,11H2,1H3,(H,47,48) |
| InChIKey | AOJBTBCYPYXKDI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.44 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|