C33H19Cl2F5N2O7 — CID 3466824
3-[6a,9a-dichloro-6-(3-hydroxyphenyl)-1,3,7,9-tetraoxo-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid (PubChem CID 3466824) has the molecular formula C33H19Cl2F5N2O7 and a molecular weight of 721.42 g/mol. Its IUPAC name is 3-[6a,9a-dichloro-6-(3-hydroxyphenyl)-1,3,7,9-tetraoxo-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid.
| Compound Name | 3-[6a,9a-dichloro-6-(3-hydroxyphenyl)-1,3,7,9-tetraoxo-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 3466824 |
| Molecular Formula | C33H19Cl2F5N2O7 |
| Molecular Weight | 721.42 g/mol |
| Exact Mass | 720.05 |
| IUPAC Name | 3-[6a,9a-dichloro-6-(3-hydroxyphenyl)-1,3,7,9-tetraoxo-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]benzoic acid |
| SMILES | O=C(O)c1cccc(N2C(=O)C3CC=C4C(CC5(Cl)C(=O)N(c6c(F)c(F)c(F)c(F)c6F)C(=O)C5(Cl)C4c4cccc(O)c4)C3C2=O)c1 |
| InChI | InChI=1S/C33H19Cl2F5N2O7/c34-32-11-18-16(7-8-17-19(18)28(45)41(27(17)44)14-5-1-4-13(9-14)29(46)47)20(12-3-2-6-15(43)10-12)33(32,35)31(49)42(30(32)48)26-24(39)22(37)21(36)23(38)25(26)40/h1-7,9-10,17-20,43H,8,11H2,(H,46,47) |
| InChIKey | XXQKUMIOVYCODQ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.42 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|