C26H15Cl2F5N2O6 — CID 5233435
6a,9a-dichloro-2-hydroxy-6-(3-hydroxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5233435) has the molecular formula C26H15Cl2F5N2O6 and a molecular weight of 617.31 g/mol. Its IUPAC name is 6a,9a-dichloro-2-hydroxy-6-(3-hydroxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-2-hydroxy-6-(3-hydroxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5233435 |
| Molecular Formula | C26H15Cl2F5N2O6 |
| Molecular Weight | 617.31 g/mol |
| Exact Mass | 616.02 |
| IUPAC Name | 6a,9a-dichloro-2-hydroxy-6-(3-hydroxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4(Cl)C(=O)N(c5c(F)c(F)c(F)c(F)c5F)C(=O)C4(Cl)C3c3cccc(O)c3)C2C(=O)N1O |
| InChI | InChI=1S/C26H15Cl2F5N2O6/c27-25-7-12-10(4-5-11-13(12)22(38)35(41)21(11)37)14(8-2-1-3-9(36)6-8)26(25,28)24(40)34(23(25)39)20-18(32)16(30)15(29)17(31)19(20)33/h1-4,6,11-14,36,41H,5,7H2 |
| InChIKey | ZEEIATDBBBNFLU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|