C33H20Cl2F6N2O5 — CID 3313206
2-benzyl-6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3313206) has the molecular formula C33H20Cl2F6N2O5 and a molecular weight of 709.43 g/mol. Its IUPAC name is 2-benzyl-6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-benzyl-6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3313206 |
| Molecular Formula | C33H20Cl2F6N2O5 |
| Molecular Weight | 709.43 g/mol |
| Exact Mass | 708.07 |
| IUPAC Name | 2-benzyl-6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-8-(2,3,4,5,6-pentafluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4(Cl)C(=O)N(c5c(F)c(F)c(F)c(F)c5F)C(=O)C4(Cl)C3c3ccc(O)c(F)c3)C2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C33H20Cl2F6N2O5/c34-32-11-17-15(7-8-16-20(17)29(46)42(28(16)45)12-13-4-2-1-3-5-13)21(14-6-9-19(44)18(36)10-14)33(32,35)31(48)43(30(32)47)27-25(40)23(38)22(37)24(39)26(27)41/h1-7,9-10,16-17,20-21,44H,8,11-12H2 |
| InChIKey | VXRIBVQRSXSAJZ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.43 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|