C26H21Cl2FN2O5S — CID 6644804
(3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-8-methyl-2-(thiophen-2-ylmethyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 6644804) has the molecular formula C26H21Cl2FN2O5S and a molecular weight of 563.43 g/mol. Its IUPAC name is (3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-8-methyl-2-(thiophen-2-ylmethyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | (3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-8-methyl-2-(thiophen-2-ylmethyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 6644804 |
| Molecular Formula | C26H21Cl2FN2O5S |
| Molecular Weight | 563.43 g/mol |
| Exact Mass | 562.05 |
| IUPAC Name | (3aS,6R,6aS,9aR,10aS,10bR)-6a,9a-dichloro-6-(3-fluoro-4-hydroxyphenyl)-8-methyl-2-(thiophen-2-ylmethyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CN1C(=O)[C@]2(Cl)C[C@@H]3C(=CC[C@@H]4C(=O)N(Cc5cccs5)C(=O)[C@@H]43)[C@H](c3ccc(O)c(F)c3)[C@]2(Cl)C1=O |
| InChI | InChI=1S/C26H21Cl2FN2O5S/c1-30-23(35)25(27)10-16-14(20(26(25,28)24(30)36)12-4-7-18(32)17(29)9-12)5-6-15-19(16)22(34)31(21(15)33)11-13-3-2-8-37-13/h2-5,7-9,15-16,19-20,32H,6,10-11H2,1H3/t15-,16+,19-,20-,25+,26-/m0/s1 |
| InChIKey | YZRPVLQECSWSJK-BTDATFQDSA-N |
| XLogP | 3.78 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|