C28H20Cl2F2N2O7 — CID 3527317
methyl 6a,9a-dichloro-6-(3-fluoro-2-hydroxyphenyl)-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 3527317) has the molecular formula C28H20Cl2F2N2O7 and a molecular weight of 605.38 g/mol. Its IUPAC name is methyl 6a,9a-dichloro-6-(3-fluoro-2-hydroxyphenyl)-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 6a,9a-dichloro-6-(3-fluoro-2-hydroxyphenyl)-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 3527317 |
| Molecular Formula | C28H20Cl2F2N2O7 |
| Molecular Weight | 605.38 g/mol |
| Exact Mass | 604.06 |
| IUPAC Name | methyl 6a,9a-dichloro-6-(3-fluoro-2-hydroxyphenyl)-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(CC4(Cl)C(=O)N(c5ccc(F)cc5)C(=O)C4(Cl)C3c3cccc(F)c3O)C2C1=O |
| InChI | InChI=1S/C28H20Cl2F2N2O7/c1-41-26(40)34-22(36)15-10-9-14-17(19(15)23(34)37)11-27(29)24(38)33(13-7-5-12(31)6-8-13)25(39)28(27,30)20(14)16-3-2-4-18(32)21(16)35/h2-9,15,17,19-20,35H,10-11H2,1H3 |
| InChIKey | XPGRVJBXWOFWFI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|