C33H24Cl2FIN2O6 — CID 3253404
6a,9a-dichloro-8-(4-fluorophenyl)-6-(2-hydroxy-3-methoxyphenyl)-2-(4-iodophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3253404) has the molecular formula C33H24Cl2FIN2O6 and a molecular weight of 761.37 g/mol. Its IUPAC name is 6a,9a-dichloro-8-(4-fluorophenyl)-6-(2-hydroxy-3-methoxyphenyl)-2-(4-iodophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-8-(4-fluorophenyl)-6-(2-hydroxy-3-methoxyphenyl)-2-(4-iodophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3253404 |
| Molecular Formula | C33H24Cl2FIN2O6 |
| Molecular Weight | 761.37 g/mol |
| Exact Mass | 760.00 |
| IUPAC Name | 6a,9a-dichloro-8-(4-fluorophenyl)-6-(2-hydroxy-3-methoxyphenyl)-2-(4-iodophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cccc(C2C3=CCC4C(=O)N(c5ccc(I)cc5)C(=O)C4C3CC3(Cl)C(=O)N(c4ccc(F)cc4)C(=O)C23Cl)c1O |
| InChI | InChI=1S/C33H24Cl2FIN2O6/c1-45-24-4-2-3-22(27(24)40)26-20-13-14-21-25(29(42)38(28(21)41)18-11-7-17(37)8-12-18)23(20)15-32(34)30(43)39(31(44)33(26,32)35)19-9-5-16(36)6-10-19/h2-13,21,23,25-26,40H,14-15H2,1H3 |
| InChIKey | PQDQESAGQLSEAQ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.37 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|