C32H21Cl3FIN2O5 — CID 3639580
6a,9a-dichloro-6-(2-chloro-4-hydroxyphenyl)-8-(4-fluorophenyl)-2-(4-iodophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3639580) has the molecular formula C32H21Cl3FIN2O5 and a molecular weight of 765.79 g/mol. Its IUPAC name is 6a,9a-dichloro-6-(2-chloro-4-hydroxyphenyl)-8-(4-fluorophenyl)-2-(4-iodophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-6-(2-chloro-4-hydroxyphenyl)-8-(4-fluorophenyl)-2-(4-iodophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3639580 |
| Molecular Formula | C32H21Cl3FIN2O5 |
| Molecular Weight | 765.79 g/mol |
| Exact Mass | 763.95 |
| IUPAC Name | 6a,9a-dichloro-6-(2-chloro-4-hydroxyphenyl)-8-(4-fluorophenyl)-2-(4-iodophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4(Cl)C(=O)N(c5ccc(F)cc5)C(=O)C4(Cl)C3c3ccc(O)cc3Cl)C2C(=O)N1c1ccc(I)cc1 |
| InChI | InChI=1S/C32H21Cl3FIN2O5/c33-24-13-19(40)9-10-21(24)26-20-11-12-22-25(28(42)38(27(22)41)17-7-3-16(37)4-8-17)23(20)14-31(34)29(43)39(30(44)32(26,31)35)18-5-1-15(36)2-6-18/h1-11,13,22-23,25-26,40H,12,14H2 |
| InChIKey | AWNOBTHVDHSEAP-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.79 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|