C29H22BrCl2FN2O8 — CID 5223850
methyl 6-(5-bromo-2-hydroxy-3-methoxyphenyl)-6a,9a-dichloro-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 5223850) has the molecular formula C29H22BrCl2FN2O8 and a molecular weight of 696.31 g/mol. Its IUPAC name is methyl 6-(5-bromo-2-hydroxy-3-methoxyphenyl)-6a,9a-dichloro-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 6-(5-bromo-2-hydroxy-3-methoxyphenyl)-6a,9a-dichloro-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 5223850 |
| Molecular Formula | C29H22BrCl2FN2O8 |
| Molecular Weight | 696.31 g/mol |
| Exact Mass | 693.99 |
| IUPAC Name | methyl 6-(5-bromo-2-hydroxy-3-methoxyphenyl)-6a,9a-dichloro-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(CC4(Cl)C(=O)N(c5ccc(F)cc5)C(=O)C4(Cl)C3c3cc(Br)cc(OC)c3O)C2C1=O |
| InChI | InChI=1S/C29H22BrCl2FN2O8/c1-42-19-10-12(30)9-17(22(19)36)21-15-7-8-16-20(24(38)35(23(16)37)27(41)43-2)18(15)11-28(31)25(39)34(26(40)29(21,28)32)14-5-3-13(33)4-6-14/h3-7,9-10,16,18,20-21,36H,8,11H2,1-2H3 |
| InChIKey | HWQXHLPRODAUBB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|