C29H24BrCl2FN2O6 — CID 5067777
6-(5-bromo-2-hydroxy-3-methoxyphenyl)-6a,9a-dichloro-2-ethyl-8-(4-fluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 5067777) has the molecular formula C29H24BrCl2FN2O6 and a molecular weight of 666.33 g/mol. Its IUPAC name is 6-(5-bromo-2-hydroxy-3-methoxyphenyl)-6a,9a-dichloro-2-ethyl-8-(4-fluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(5-bromo-2-hydroxy-3-methoxyphenyl)-6a,9a-dichloro-2-ethyl-8-(4-fluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 5067777 |
| Molecular Formula | C29H24BrCl2FN2O6 |
| Molecular Weight | 666.33 g/mol |
| Exact Mass | 664.02 |
| IUPAC Name | 6-(5-bromo-2-hydroxy-3-methoxyphenyl)-6a,9a-dichloro-2-ethyl-8-(4-fluorophenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCN1C(=O)C2CC=C3C(CC4(Cl)C(=O)N(c5ccc(F)cc5)C(=O)C4(Cl)C3c3cc(Br)cc(OC)c3O)C2C1=O |
| InChI | InChI=1S/C29H24BrCl2FN2O6/c1-3-34-24(37)17-9-8-16-19(21(17)25(34)38)12-28(31)26(39)35(15-6-4-14(33)5-7-15)27(40)29(28,32)22(16)18-10-13(30)11-20(41-2)23(18)36/h4-8,10-11,17,19,21-22,36H,3,9,12H2,1-2H3 |
| InChIKey | ZNVPDQCNUNYQMW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.33 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|