C30H25Cl2FN2O8 — CID 4603980
methyl 6a,9a-dichloro-6-(3-ethoxy-2-hydroxyphenyl)-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 4603980) has the molecular formula C30H25Cl2FN2O8 and a molecular weight of 631.44 g/mol. Its IUPAC name is methyl 6a,9a-dichloro-6-(3-ethoxy-2-hydroxyphenyl)-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 6a,9a-dichloro-6-(3-ethoxy-2-hydroxyphenyl)-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 4603980 |
| Molecular Formula | C30H25Cl2FN2O8 |
| Molecular Weight | 631.44 g/mol |
| Exact Mass | 630.10 |
| IUPAC Name | methyl 6a,9a-dichloro-6-(3-ethoxy-2-hydroxyphenyl)-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | CCOc1cccc(C2C3=CCC4C(=O)N(C(=O)OC)C(=O)C4C3CC3(Cl)C(=O)N(c4ccc(F)cc4)C(=O)C23Cl)c1O |
| InChI | InChI=1S/C30H25Cl2FN2O8/c1-3-43-20-6-4-5-18(23(20)36)22-16-11-12-17-21(25(38)35(24(17)37)28(41)42-2)19(16)13-29(31)26(39)34(27(40)30(22,29)32)15-9-7-14(33)8-10-15/h4-11,17,19,21-22,36H,3,12-13H2,1-2H3 |
| InChIKey | BCYGNMRIWHEUAA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|