C31H30N2O8 — CID 4130622
methyl 6-(3-ethoxy-2-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 4130622) has the molecular formula C31H30N2O8 and a molecular weight of 558.59 g/mol. Its IUPAC name is methyl 6-(3-ethoxy-2-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 6-(3-ethoxy-2-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 4130622 |
| Molecular Formula | C31H30N2O8 |
| Molecular Weight | 558.59 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | methyl 6-(3-ethoxy-2-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | CCOc1cccc(C2C3=CCC4C(=O)N(C(=O)OC)C(=O)C4C3CC3C(=O)N(c4ccccc4)C(=O)C32C)c1O |
| InChI | InChI=1S/C31H30N2O8/c1-4-41-22-12-8-11-19(25(22)34)24-17-13-14-18-23(28(37)33(26(18)35)30(39)40-3)20(17)15-21-27(36)32(29(38)31(21,24)2)16-9-6-5-7-10-16/h5-13,18,20-21,23-24,34H,4,14-15H2,1-3H3 |
| InChIKey | QSDDJAMWFWTCAA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|