C37H30F6N2O6 — CID 3394202
2-[3,5-bis(trifluoromethyl)phenyl]-6-(3-ethoxy-2-hydroxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3394202) has the molecular formula C37H30F6N2O6 and a molecular weight of 712.64 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]-6-(3-ethoxy-2-hydroxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]-6-(3-ethoxy-2-hydroxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3394202 |
| Molecular Formula | C37H30F6N2O6 |
| Molecular Weight | 712.64 g/mol |
| Exact Mass | 712.20 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]-6-(3-ethoxy-2-hydroxyphenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCOc1cccc(C2C3=CCC4C(=O)N(c5cc(C(F)(F)F)cc(C(F)(F)F)c5)C(=O)C4C3CC3C(=O)N(c4ccccc4)C(=O)C32C)c1O |
| InChI | InChI=1S/C37H30F6N2O6/c1-3-51-27-11-7-10-24(30(27)46)29-22-12-13-23-28(25(22)17-26-32(48)45(34(50)35(26,29)2)20-8-5-4-6-9-20)33(49)44(31(23)47)21-15-18(36(38,39)40)14-19(16-21)37(41,42)43/h4-12,14-16,23,25-26,28-29,46H,3,13,17H2,1-2H3 |
| InChIKey | GPHODBWBJUYGJV-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.64 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|