C33H28N2O7 — CID 4147530
methyl 6-(4-hydroxynaphthalen-1-yl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 4147530) has the molecular formula C33H28N2O7 and a molecular weight of 564.59 g/mol. Its IUPAC name is methyl 6-(4-hydroxynaphthalen-1-yl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 6-(4-hydroxynaphthalen-1-yl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 4147530 |
| Molecular Formula | C33H28N2O7 |
| Molecular Weight | 564.59 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | methyl 6-(4-hydroxynaphthalen-1-yl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(CC4C(=O)N(c5ccccc5)C(=O)C4(C)C3c3ccc(O)c4ccccc34)C2C1=O |
| InChI | InChI=1S/C33H28N2O7/c1-33-24(29(38)34(31(33)40)17-8-4-3-5-9-17)16-23-21(12-13-22-26(23)30(39)35(28(22)37)32(41)42-2)27(33)20-14-15-25(36)19-11-7-6-10-18(19)20/h3-12,14-15,22-24,26-27,36H,13,16H2,1-2H3 |
| InChIKey | JERZOIKRTHQROR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|