C38H32N2O5 — CID 4171634
2-benzyl-6-(4-hydroxynaphthalen-1-yl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4171634) has the molecular formula C38H32N2O5 and a molecular weight of 596.68 g/mol. Its IUPAC name is 2-benzyl-6-(4-hydroxynaphthalen-1-yl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-benzyl-6-(4-hydroxynaphthalen-1-yl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4171634 |
| Molecular Formula | C38H32N2O5 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | 2-benzyl-6-(4-hydroxynaphthalen-1-yl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CC12C(=O)N(c3ccccc3)C(=O)C1CC1C(=CCC3C(=O)N(Cc4ccccc4)C(=O)C31)C2c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C38H32N2O5/c1-38-30(35(43)40(37(38)45)23-12-6-3-7-13-23)20-29-27(33(38)26-18-19-31(41)25-15-9-8-14-24(25)26)16-17-28-32(29)36(44)39(34(28)42)21-22-10-4-2-5-11-22/h2-16,18-19,28-30,32-33,41H,17,20-21H2,1H3 |
| InChIKey | HNZCXBBYRLDFTP-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|