C33H30N2O5 — CID 6659811
(3aS,6R,6aS,9aR,10aS,10bR)-2-ethyl-6-(2-hydroxynaphthalen-1-yl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 6659811) has the molecular formula C33H30N2O5 and a molecular weight of 534.61 g/mol. Its IUPAC name is (3aS,6R,6aS,9aR,10aS,10bR)-2-ethyl-6-(2-hydroxynaphthalen-1-yl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | (3aS,6R,6aS,9aR,10aS,10bR)-2-ethyl-6-(2-hydroxynaphthalen-1-yl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 6659811 |
| Molecular Formula | C33H30N2O5 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | (3aS,6R,6aS,9aR,10aS,10bR)-2-ethyl-6-(2-hydroxynaphthalen-1-yl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCN1C(=O)[C@H]2[C@H](CC=C3[C@H]2C[C@H]2C(=O)N(c4ccccc4)C(=O)[C@@]2(C)[C@H]3c2c(O)ccc3ccccc23)C1=O |
| InChI | InChI=1S/C33H30N2O5/c1-3-34-29(37)22-15-14-21-23(26(22)31(34)39)17-24-30(38)35(19-10-5-4-6-11-19)32(40)33(24,2)28(21)27-20-12-8-7-9-18(20)13-16-25(27)36/h4-14,16,22-24,26,28,36H,3,15,17H2,1-2H3/t22-,23+,24-,26-,28+,33+/m0/s1 |
| InChIKey | YLOHWMNIRSBXTH-BZLIVHJRSA-N |
| XLogP | 4.80 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|