C31H32N2O6 — CID 4048356
2-ethyl-6-[4-(2-hydroxyethoxy)phenyl]-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4048356) has the molecular formula C31H32N2O6 and a molecular weight of 528.61 g/mol. Its IUPAC name is 2-ethyl-6-[4-(2-hydroxyethoxy)phenyl]-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-ethyl-6-[4-(2-hydroxyethoxy)phenyl]-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4048356 |
| Molecular Formula | C31H32N2O6 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | 2-ethyl-6-[4-(2-hydroxyethoxy)phenyl]-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CCN1C(=O)C2CC=C3C(CC4C(=O)N(c5ccccc5)C(=O)C4(C)C3c3ccc(OCCO)cc3)C2C1=O |
| InChI | InChI=1S/C31H32N2O6/c1-3-32-27(35)22-14-13-21-23(25(22)29(32)37)17-24-28(36)33(19-7-5-4-6-8-19)30(38)31(24,2)26(21)18-9-11-20(12-10-18)39-16-15-34/h4-13,22-26,34H,3,14-17H2,1-2H3 |
| InChIKey | MTPBIZFEPLTEMU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|