C35H32N2O7 — CID 6660069
4-[(3aS,6R,6aS,9aR,10aS,10bR)-6-(4-hydroxynaphthalen-1-yl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid (PubChem CID 6660069) has the molecular formula C35H32N2O7 and a molecular weight of 592.65 g/mol. Its IUPAC name is 4-[(3aS,6R,6aS,9aR,10aS,10bR)-6-(4-hydroxynaphthalen-1-yl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[(3aS,6R,6aS,9aR,10aS,10bR)-6-(4-hydroxynaphthalen-1-yl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 6660069 |
| Molecular Formula | C35H32N2O7 |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | 4-[(3aS,6R,6aS,9aR,10aS,10bR)-6-(4-hydroxynaphthalen-1-yl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]butanoic acid |
| SMILES | C[C@@]12C(=O)N(c3ccccc3)C(=O)[C@@H]1C[C@@H]1C(=CC[C@@H]3C(=O)N(CCCC(=O)O)C(=O)[C@@H]31)[C@@H]2c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C35H32N2O7/c1-35-26(32(42)37(34(35)44)19-8-3-2-4-9-19)18-25-23(30(35)22-15-16-27(38)21-11-6-5-10-20(21)22)13-14-24-29(25)33(43)36(31(24)41)17-7-12-28(39)40/h2-6,8-11,13,15-16,24-26,29-30,38H,7,12,14,17-18H2,1H3,(H,39,40)/t24-,25+,26-,29-,30-,35+/m0/s1 |
| InChIKey | IBJMIATVWAZQBJ-XLFILKDVSA-N |
| XLogP | 4.64 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|