C34H36N2O8 — CID 4062004
6-[6-(4-hydroxy-3-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]hexanoic acid (PubChem CID 4062004) has the molecular formula C34H36N2O8 and a molecular weight of 600.67 g/mol. Its IUPAC name is 6-[6-(4-hydroxy-3-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]hexanoic acid.
| Compound Name | 6-[6-(4-hydroxy-3-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 4062004 |
| Molecular Formula | C34H36N2O8 |
| Molecular Weight | 600.67 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 6-[6-(4-hydroxy-3-methoxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]hexanoic acid |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(CCCCCC(=O)O)C(=O)C4C3CC3C(=O)N(c4ccccc4)C(=O)C32C)ccc1O |
| InChI | InChI=1S/C34H36N2O8/c1-34-24(31(41)36(33(34)43)20-9-5-3-6-10-20)18-23-21(29(34)19-12-15-25(37)26(17-19)44-2)13-14-22-28(23)32(42)35(30(22)40)16-8-4-7-11-27(38)39/h3,5-6,9-10,12-13,15,17,22-24,28-29,37H,4,7-8,11,14,16,18H2,1-2H3,(H,38,39) |
| InChIKey | JCRPTCRCHYTHAO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.67 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|