C30H27ClN2O7 — CID 6657902
3-[(3aS,6S,6aS,9aR,10aS,10bR)-6-(2-chloro-4-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid (PubChem CID 6657902) has the molecular formula C30H27ClN2O7 and a molecular weight of 563.01 g/mol. Its IUPAC name is 3-[(3aS,6S,6aS,9aR,10aS,10bR)-6-(2-chloro-4-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid.
| Compound Name | 3-[(3aS,6S,6aS,9aR,10aS,10bR)-6-(2-chloro-4-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 6657902 |
| Molecular Formula | C30H27ClN2O7 |
| Molecular Weight | 563.01 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | 3-[(3aS,6S,6aS,9aR,10aS,10bR)-6-(2-chloro-4-hydroxyphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindol-2-yl]propanoic acid |
| SMILES | C[C@@]12C(=O)N(c3ccccc3)C(=O)[C@@H]1C[C@@H]1C(=CC[C@@H]3C(=O)N(CCC(=O)O)C(=O)[C@@H]31)[C@@H]2c1ccc(O)cc1Cl |
| InChI | InChI=1S/C30H27ClN2O7/c1-30-21(27(38)33(29(30)40)15-5-3-2-4-6-15)14-20-17(25(30)18-8-7-16(34)13-22(18)31)9-10-19-24(20)28(39)32(26(19)37)12-11-23(35)36/h2-9,13,19-21,24-25,34H,10-12,14H2,1H3,(H,35,36)/t19-,20+,21-,24-,25+,30+/m0/s1 |
| InChIKey | HZZBUFVKUIBKAQ-BWZWJDASSA-N |
| XLogP | 3.75 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.01 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|