C37H29IN2O5 — CID 4200875
6-(4-hydroxynaphthalen-1-yl)-2-(4-iodophenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4200875) has the molecular formula C37H29IN2O5 and a molecular weight of 708.55 g/mol. Its IUPAC name is 6-(4-hydroxynaphthalen-1-yl)-2-(4-iodophenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6-(4-hydroxynaphthalen-1-yl)-2-(4-iodophenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4200875 |
| Molecular Formula | C37H29IN2O5 |
| Molecular Weight | 708.55 g/mol |
| Exact Mass | 708.11 |
| IUPAC Name | 6-(4-hydroxynaphthalen-1-yl)-2-(4-iodophenyl)-6a-methyl-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | CC12C(=O)N(c3ccccc3)C(=O)C1CC1C(=CCC3C(=O)N(c4ccc(I)cc4)C(=O)C31)C2c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C37H29IN2O5/c1-37-29(34(43)40(36(37)45)21-7-3-2-4-8-21)19-28-26(32(37)25-17-18-30(41)24-10-6-5-9-23(24)25)15-16-27-31(28)35(44)39(33(27)42)22-13-11-20(38)12-14-22/h2-15,17-18,27-29,31-32,41H,16,19H2,1H3 |
| InChIKey | CWFJZPZNAFRGBJ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.55 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|