C31H30N2O7 — CID 4318701
methyl 6-(4-hydroxy-3,5-dimethylphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate (PubChem CID 4318701) has the molecular formula C31H30N2O7 and a molecular weight of 542.59 g/mol. Its IUPAC name is methyl 6-(4-hydroxy-3,5-dimethylphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate.
| Compound Name | methyl 6-(4-hydroxy-3,5-dimethylphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 4318701 |
| Molecular Formula | C31H30N2O7 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | methyl 6-(4-hydroxy-3,5-dimethylphenyl)-6a-methyl-1,3,7,9-tetraoxo-8-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)C2CC=C3C(CC4C(=O)N(c5ccccc5)C(=O)C4(C)C3c3cc(C)c(O)c(C)c3)C2C1=O |
| InChI | InChI=1S/C31H30N2O7/c1-15-12-17(13-16(2)25(15)34)24-19-10-11-20-23(28(37)33(26(20)35)30(39)40-4)21(19)14-22-27(36)32(29(38)31(22,24)3)18-8-6-5-7-9-18/h5-10,12-13,20-24,34H,11,14H2,1-4H3 |
| InChIKey | KOJSTGJCVFGEMR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 121.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|