C29H22BrCl3N2O5 — CID 3675248
8-(bromomethyl)-6a,9a-dichloro-6-(5-chloro-2-hydroxyphenyl)-2-(4-ethenylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3675248) has the molecular formula C29H22BrCl3N2O5 and a molecular weight of 664.77 g/mol. Its IUPAC name is 8-(bromomethyl)-6a,9a-dichloro-6-(5-chloro-2-hydroxyphenyl)-2-(4-ethenylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(bromomethyl)-6a,9a-dichloro-6-(5-chloro-2-hydroxyphenyl)-2-(4-ethenylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3675248 |
| Molecular Formula | C29H22BrCl3N2O5 |
| Molecular Weight | 664.77 g/mol |
| Exact Mass | 661.98 |
| IUPAC Name | 8-(bromomethyl)-6a,9a-dichloro-6-(5-chloro-2-hydroxyphenyl)-2-(4-ethenylphenyl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | C=Cc1ccc(N2C(=O)C3CC=C4C(CC5(Cl)C(=O)N(CBr)C(=O)C5(Cl)C4c4cc(Cl)ccc4O)C3C2=O)cc1 |
| InChI | InChI=1S/C29H22BrCl3N2O5/c1-2-14-3-6-16(7-4-14)35-24(37)18-9-8-17-20(22(18)25(35)38)12-28(32)26(39)34(13-30)27(40)29(28,33)23(17)19-11-15(31)5-10-21(19)36/h2-8,10-11,18,20,22-23,36H,1,9,12-13H2 |
| InChIKey | YKQWIBREZHOSLM-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.77 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|