C31H26Cl3FN2O8 — CID 4206111
4-[6a,9a-dichloro-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid (PubChem CID 4206111) has the molecular formula C31H26Cl3FN2O8 and a molecular weight of 679.91 g/mol. Its IUPAC name is 4-[6a,9a-dichloro-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[6a,9a-dichloro-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 4206111 |
| Molecular Formula | C31H26Cl3FN2O8 |
| Molecular Weight | 679.91 g/mol |
| Exact Mass | 678.07 |
| IUPAC Name | 4-[6a,9a-dichloro-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(CCCC(=O)O)C(=O)C4C3CC3(Cl)C(=O)N(c4ccc(F)cc4)C(=O)C23Cl)cc(Cl)c1O |
| InChI | InChI=1S/C31H26Cl3FN2O8/c1-45-21-12-14(11-20(32)25(21)40)24-17-8-9-18-23(27(42)36(26(18)41)10-2-3-22(38)39)19(17)13-30(33)28(43)37(29(44)31(24,30)34)16-6-4-15(35)5-7-16/h4-8,11-12,18-19,23-24,40H,2-3,9-10,13H2,1H3,(H,38,39) |
| InChIKey | XAQPEBNCMOJTPI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.91 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|