C34H24Cl3FN2O9 — CID 4551074
4-[6a,9a-dichloro-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]-2-hydroxybenzoic acid (PubChem CID 4551074) has the molecular formula C34H24Cl3FN2O9 and a molecular weight of 729.93 g/mol. Its IUPAC name is 4-[6a,9a-dichloro-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]-2-hydroxybenzoic acid.
| Compound Name | 4-[6a,9a-dichloro-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 4551074 |
| Molecular Formula | C34H24Cl3FN2O9 |
| Molecular Weight | 729.93 g/mol |
| Exact Mass | 728.05 |
| IUPAC Name | 4-[6a,9a-dichloro-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-8-(4-fluorophenyl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]-2-hydroxybenzoic acid |
| SMILES | COc1cc(C2C3=CCC4C(=O)N(c5ccc(C(=O)O)c(O)c5)C(=O)C4C3CC3(Cl)C(=O)N(c4ccc(F)cc4)C(=O)C23Cl)cc(Cl)c1O |
| InChI | InChI=1S/C34H24Cl3FN2O9/c1-49-24-11-14(10-22(35)27(24)42)26-18-8-9-20-25(29(44)39(28(20)43)17-6-7-19(30(45)46)23(41)12-17)21(18)13-33(36)31(47)40(32(48)34(26,33)37)16-4-2-15(38)3-5-16/h2-8,10-12,20-21,25-26,41-42H,9,13H2,1H3,(H,45,46) |
| InChIKey | MOJOTJQNRINQNX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 161.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.93 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|