C33H27Cl2FN2O8 — CID 4319003
4-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(6-hydroxy-4H-chromen-3-yl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid (PubChem CID 4319003) has the molecular formula C33H27Cl2FN2O8 and a molecular weight of 669.49 g/mol. Its IUPAC name is 4-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(6-hydroxy-4H-chromen-3-yl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(6-hydroxy-4H-chromen-3-yl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 4319003 |
| Molecular Formula | C33H27Cl2FN2O8 |
| Molecular Weight | 669.49 g/mol |
| Exact Mass | 668.11 |
| IUPAC Name | 4-[6a,9a-dichloro-8-(4-fluorophenyl)-6-(6-hydroxy-4H-chromen-3-yl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C2CC=C3C(CC4(Cl)C(=O)N(c5ccc(F)cc5)C(=O)C4(Cl)C3C3=COc4ccc(O)cc4C3)C2C1=O |
| InChI | InChI=1S/C33H27Cl2FN2O8/c34-32-14-23-21(8-9-22-26(23)29(43)37(28(22)42)11-1-2-25(40)41)27(17-12-16-13-20(39)7-10-24(16)46-15-17)33(32,35)31(45)38(30(32)44)19-5-3-18(36)4-6-19/h3-8,10,13,15,22-23,26-27,39H,1-2,9,11-12,14H2,(H,40,41) |
| InChIKey | ATSNHRQEGSRVLZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|