C30H29BrCl2N2O8 — CID 4163488
6-[8-(bromomethyl)-6a,9a-dichloro-6-(6-hydroxy-4H-chromen-3-yl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]hexanoic acid (PubChem CID 4163488) has the molecular formula C30H29BrCl2N2O8 and a molecular weight of 696.38 g/mol. Its IUPAC name is 6-[8-(bromomethyl)-6a,9a-dichloro-6-(6-hydroxy-4H-chromen-3-yl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]hexanoic acid.
| Compound Name | 6-[8-(bromomethyl)-6a,9a-dichloro-6-(6-hydroxy-4H-chromen-3-yl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 4163488 |
| Molecular Formula | C30H29BrCl2N2O8 |
| Molecular Weight | 696.38 g/mol |
| Exact Mass | 694.05 |
| IUPAC Name | 6-[8-(bromomethyl)-6a,9a-dichloro-6-(6-hydroxy-4H-chromen-3-yl)-1,3,7,9-tetraoxo-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindol-2-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)C2CC=C3C(CC4(Cl)C(=O)N(CBr)C(=O)C4(Cl)C3C3=COc4ccc(O)cc4C3)C2C1=O |
| InChI | InChI=1S/C30H29BrCl2N2O8/c31-14-35-27(41)29(32)12-20-18(6-7-19-23(20)26(40)34(25(19)39)9-3-1-2-4-22(37)38)24(30(29,33)28(35)42)16-10-15-11-17(36)5-8-21(15)43-13-16/h5-6,8,11,13,19-20,23-24,36H,1-4,7,9-10,12,14H2,(H,37,38) |
| InChIKey | JILBAWUCZPUEJW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 141.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|