C29H21Cl2FN2O7 — CID 3447162
6a,9a-dichloro-8-(4-fluorophenyl)-2-hydroxy-6-(6-hydroxy-4H-chromen-3-yl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 3447162) has the molecular formula C29H21Cl2FN2O7 and a molecular weight of 599.40 g/mol. Its IUPAC name is 6a,9a-dichloro-8-(4-fluorophenyl)-2-hydroxy-6-(6-hydroxy-4H-chromen-3-yl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 6a,9a-dichloro-8-(4-fluorophenyl)-2-hydroxy-6-(6-hydroxy-4H-chromen-3-yl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 3447162 |
| Molecular Formula | C29H21Cl2FN2O7 |
| Molecular Weight | 599.40 g/mol |
| Exact Mass | 598.07 |
| IUPAC Name | 6a,9a-dichloro-8-(4-fluorophenyl)-2-hydroxy-6-(6-hydroxy-4H-chromen-3-yl)-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | O=C1C2CC=C3C(CC4(Cl)C(=O)N(c5ccc(F)cc5)C(=O)C4(Cl)C3C3=COc4ccc(O)cc4C3)C2C(=O)N1O |
| InChI | InChI=1S/C29H21Cl2FN2O7/c30-28-11-20-18(6-7-19-22(20)25(37)34(40)24(19)36)23(14-9-13-10-17(35)5-8-21(13)41-12-14)29(28,31)27(39)33(26(28)38)16-3-1-15(32)2-4-16/h1-6,8,10,12,19-20,22-23,35,40H,7,9,11H2 |
| InChIKey | CIGPKOLQXJYOBZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|